C15H17NO4S — CID 63985143
4-[3-(methoxymethyl)phenoxy]-2-methylbenzenesulfonamide (PubChem CID 63985143) has the molecular formula C15H17NO4S and a molecular weight of 307.37 g/mol. Its IUPAC name is 4-[3-(methoxymethyl)phenoxy]-2-methylbenzenesulfonamide.
| Compound Name | 4-[3-(methoxymethyl)phenoxy]-2-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 63985143 |
| Molecular Formula | C15H17NO4S |
| Molecular Weight | 307.37 g/mol |
| Exact Mass | 307.09 |
| IUPAC Name | 4-[3-(methoxymethyl)phenoxy]-2-methylbenzenesulfonamide |
| SMILES | COCc1cccc(Oc2ccc(S(N)(=O)=O)c(C)c2)c1 |
| InChI | InChI=1S/C15H17NO4S/c1-11-8-14(6-7-15(11)21(16,17)18)20-13-5-3-4-12(9-13)10-19-2/h3-9H,10H2,1-2H3,(H2,16,17,18) |
| InChIKey | HCNLUDGWNGMBOB-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 78.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.37 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |