C16H20N2O3S — CID 44609064
4-(3,4-dimethylphenoxy)-3-(methylaminomethyl)benzenesulfonamide (PubChem CID 44609064) has the molecular formula C16H20N2O3S and a molecular weight of 320.41 g/mol. Its IUPAC name is 4-(3,4-dimethylphenoxy)-3-(methylaminomethyl)benzenesulfonamide.
| Compound Name | 4-(3,4-dimethylphenoxy)-3-(methylaminomethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 44609064 |
| Molecular Formula | C16H20N2O3S |
| Molecular Weight | 320.41 g/mol |
| Exact Mass | 320.12 |
| IUPAC Name | 4-(3,4-dimethylphenoxy)-3-(methylaminomethyl)benzenesulfonamide |
| SMILES | CNCc1cc(S(N)(=O)=O)ccc1Oc1ccc(C)c(C)c1 |
| InChI | InChI=1S/C16H20N2O3S/c1-11-4-5-14(8-12(11)2)21-16-7-6-15(22(17,19)20)9-13(16)10-18-3/h4-9,18H,10H2,1-3H3,(H2,17,19,20) |
| InChIKey | JUHJKFDYVSQADM-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.41 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |