C19H24N2O3S2 — CID 59143904
4-(3-methyl-4-methylsulfanylphenoxy)-3-(pyrrolidin-1-ylmethyl)benzenesulfonamide (PubChem CID 59143904) has the molecular formula C19H24N2O3S2 and a molecular weight of 392.55 g/mol. Its IUPAC name is 4-(3-methyl-4-methylsulfanylphenoxy)-3-(pyrrolidin-1-ylmethyl)benzenesulfonamide.
| Compound Name | 4-(3-methyl-4-methylsulfanylphenoxy)-3-(pyrrolidin-1-ylmethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 59143904 |
| Molecular Formula | C19H24N2O3S2 |
| Molecular Weight | 392.55 g/mol |
| Exact Mass | 392.12 |
| IUPAC Name | 4-(3-methyl-4-methylsulfanylphenoxy)-3-(pyrrolidin-1-ylmethyl)benzenesulfonamide |
| SMILES | CSc1ccc(Oc2ccc(S(N)(=O)=O)cc2CN2CCCC2)cc1C |
| InChI | InChI=1S/C19H24N2O3S2/c1-14-11-16(5-8-19(14)25-2)24-18-7-6-17(26(20,22)23)12-15(18)13-21-9-3-4-10-21/h5-8,11-12H,3-4,9-10,13H2,1-2H3,(H2,20,22,23) |
| InChIKey | UUEGIIXKKOHRSP-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 72.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.55 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |