C18H20N2OS — CID 59143832
1-[5-isocyano-2-(3-methyl-4-methylsulfanylphenoxy)phenyl]-N,N-dimethylmethanamine (PubChem CID 59143832) has the molecular formula C18H20N2OS and a molecular weight of 312.44 g/mol. Its IUPAC name is 1-[5-isocyano-2-(3-methyl-4-methylsulfanylphenoxy)phenyl]-N,N-dimethylmethanamine.
| Compound Name | 1-[5-isocyano-2-(3-methyl-4-methylsulfanylphenoxy)phenyl]-N,N-dimethylmethanamine |
|---|---|
| PubChem CID | 59143832 |
| Molecular Formula | C18H20N2OS |
| Molecular Weight | 312.44 g/mol |
| Exact Mass | 312.13 |
| IUPAC Name | 1-[5-isocyano-2-(3-methyl-4-methylsulfanylphenoxy)phenyl]-N,N-dimethylmethanamine |
| SMILES | [C-]#[N+]c1ccc(Oc2ccc(SC)c(C)c2)c(CN(C)C)c1 |
| InChI | InChI=1S/C18H20N2OS/c1-13-10-16(7-9-18(13)22-5)21-17-8-6-15(19-2)11-14(17)12-20(3)4/h6-11H,12H2,1,3-5H3 |
| InChIKey | CBNMNRIOKWNRKG-UHFFFAOYSA-N |
| XLogP | 5.12 |
| TPSA | 16.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.44 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|