C14H13Cl2NOS — CID 23451804
4-(3,4-dichlorophenoxy)-3-ethylsulfanylaniline (PubChem CID 23451804) has the molecular formula C14H13Cl2NOS and a molecular weight of 314.24 g/mol. Its IUPAC name is 4-(3,4-dichlorophenoxy)-3-ethylsulfanylaniline.
| Compound Name | 4-(3,4-dichlorophenoxy)-3-ethylsulfanylaniline |
|---|---|
| PubChem CID | 23451804 |
| Molecular Formula | C14H13Cl2NOS |
| Molecular Weight | 314.24 g/mol |
| Exact Mass | 313.01 |
| IUPAC Name | 4-(3,4-dichlorophenoxy)-3-ethylsulfanylaniline |
| SMILES | CCSc1cc(N)ccc1Oc1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C14H13Cl2NOS/c1-2-19-14-7-9(17)3-6-13(14)18-10-4-5-11(15)12(16)8-10/h3-8H,2,17H2,1H3 |
| InChIKey | YDCFRRGOXNWHOO-UHFFFAOYSA-N |
| XLogP | 5.48 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.24 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|