C20H25Cl2N2O4S+ — CID 23451824
carbamoyl-[4-(3,4-dichlorophenoxy)-3-ethylsulfanylphenyl]-(2,2-dimethoxyethyl)-methylazanium (PubChem CID 23451824) has the molecular formula C20H25Cl2N2O4S+ and a molecular weight of 460.40 g/mol. Its IUPAC name is carbamoyl-[4-(3,4-dichlorophenoxy)-3-ethylsulfanylphenyl]-(2,2-dimethoxyethyl)-methylazanium.
| Compound Name | carbamoyl-[4-(3,4-dichlorophenoxy)-3-ethylsulfanylphenyl]-(2,2-dimethoxyethyl)-methylazanium |
|---|---|
| PubChem CID | 23451824 |
| Molecular Formula | C20H25Cl2N2O4S+ |
| Molecular Weight | 460.40 g/mol |
| Exact Mass | 459.09 |
| IUPAC Name | carbamoyl-[4-(3,4-dichlorophenoxy)-3-ethylsulfanylphenyl]-(2,2-dimethoxyethyl)-methylazanium |
| SMILES | CCSc1cc([N+](C)(CC(OC)OC)C(N)=O)ccc1Oc1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C20H24Cl2N2O4S/c1-5-29-18-10-13(24(2,20(23)25)12-19(26-3)27-4)6-9-17(18)28-14-7-8-15(21)16(22)11-14/h6-11,19H,5,12H2,1-4H3,(H-,23,25)/p+1 |
| InChIKey | KKQQHVCHADIPOW-UHFFFAOYSA-O |
| XLogP | 5.53 |
| TPSA | 70.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.40 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|