C15H11Cl3O2S — CID 66573868
2-[[2-(3,4-dichlorophenoxy)phenyl]methylsulfanyl]acetyl chloride (PubChem CID 66573868) has the molecular formula C15H11Cl3O2S and a molecular weight of 361.68 g/mol. Its IUPAC name is 2-[[2-(3,4-dichlorophenoxy)phenyl]methylsulfanyl]acetyl chloride.
| Compound Name | 2-[[2-(3,4-dichlorophenoxy)phenyl]methylsulfanyl]acetyl chloride |
|---|---|
| PubChem CID | 66573868 |
| Molecular Formula | C15H11Cl3O2S |
| Molecular Weight | 361.68 g/mol |
| Exact Mass | 359.95 |
| IUPAC Name | 2-[[2-(3,4-dichlorophenoxy)phenyl]methylsulfanyl]acetyl chloride |
| SMILES | O=C(Cl)CSCc1ccccc1Oc1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C15H11Cl3O2S/c16-12-6-5-11(7-13(12)17)20-14-4-2-1-3-10(14)8-21-9-15(18)19/h1-7H,8-9H2 |
| InChIKey | KVGXGDRCSRHIBB-UHFFFAOYSA-N |
| XLogP | 5.78 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.68 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'} |
|---|