C13H18BrClN2O4P+ — CID 24801955
2-[(5-bromo-6-chloro-1H-indol-3-yl)oxy-hydroxyphosphoryl]oxyethyl-trimethylazanium (PubChem CID 24801955) has the molecular formula C13H18BrClN2O4P+ and a molecular weight of 412.63 g/mol. Its IUPAC name is 2-[(5-bromo-6-chloro-1H-indol-3-yl)oxy-hydroxyphosphoryl]oxyethyl-trimethylazanium.
| Compound Name | 2-[(5-bromo-6-chloro-1H-indol-3-yl)oxy-hydroxyphosphoryl]oxyethyl-trimethylazanium |
|---|---|
| PubChem CID | 24801955 |
| Molecular Formula | C13H18BrClN2O4P+ |
| Molecular Weight | 412.63 g/mol |
| Exact Mass | 410.99 |
| IUPAC Name | 2-[(5-bromo-6-chloro-1H-indol-3-yl)oxy-hydroxyphosphoryl]oxyethyl-trimethylazanium |
| SMILES | C[N+](C)(C)CCOP(=O)(O)Oc1c[nH]c2cc(Cl)c(Br)cc12 |
| InChI | InChI=1S/C13H17BrClN2O4P/c1-17(2,3)4-5-20-22(18,19)21-13-8-16-12-7-11(15)10(14)6-9(12)13/h6-8,16H,4-5H2,1-3H3/p+1 |
| InChIKey | NZAYYRWXAYVGMD-UHFFFAOYSA-O |
| XLogP | 3.79 |
| TPSA | 71.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.63 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|