C16H12Cl2N2O7P2 — CID 16666842
(6-chloro-1H-indol-3-yl) [(6-chloro-1H-indol-3-yl)oxy-hydroxyphosphoryl] hydrogen phosphate (PubChem CID 16666842) has the molecular formula C16H12Cl2N2O7P2 and a molecular weight of 477.13 g/mol. Its IUPAC name is (6-chloro-1H-indol-3-yl) [(6-chloro-1H-indol-3-yl)oxy-hydroxyphosphoryl] hydrogen phosphate.
| Compound Name | (6-chloro-1H-indol-3-yl) [(6-chloro-1H-indol-3-yl)oxy-hydroxyphosphoryl] hydrogen phosphate |
|---|---|
| PubChem CID | 16666842 |
| Molecular Formula | C16H12Cl2N2O7P2 |
| Molecular Weight | 477.13 g/mol |
| Exact Mass | 475.95 |
| IUPAC Name | (6-chloro-1H-indol-3-yl) [(6-chloro-1H-indol-3-yl)oxy-hydroxyphosphoryl] hydrogen phosphate |
| SMILES | O=P(O)(Oc1c[nH]c2cc(Cl)ccc12)OP(=O)(O)Oc1c[nH]c2cc(Cl)ccc12 |
| InChI | InChI=1S/C16H12Cl2N2O7P2/c17-9-1-3-11-13(5-9)19-7-15(11)25-28(21,22)27-29(23,24)26-16-8-20-14-6-10(18)2-4-12(14)16/h1-8,19-20H,(H,21,22)(H,23,24) |
| InChIKey | ZYFGUDMEKXPEKO-UHFFFAOYSA-N |
| XLogP | 5.63 |
| TPSA | 133.87 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.13 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|