C11H9ClINO2 — CID 121353891
3-(6-chloro-1H-indol-3-yl)-2-iodopropanoic acid (PubChem CID 121353891) has the molecular formula C11H9ClINO2 and a molecular weight of 349.56 g/mol. Its IUPAC name is 3-(6-chloro-1H-indol-3-yl)-2-iodopropanoic acid.
| Compound Name | 3-(6-chloro-1H-indol-3-yl)-2-iodopropanoic acid |
|---|---|
| PubChem CID | 121353891 |
| Molecular Formula | C11H9ClINO2 |
| Molecular Weight | 349.56 g/mol |
| Exact Mass | 348.94 |
| IUPAC Name | 3-(6-chloro-1H-indol-3-yl)-2-iodopropanoic acid |
| SMILES | O=C(O)C(I)Cc1c[nH]c2cc(Cl)ccc12 |
| InChI | InChI=1S/C11H9ClINO2/c12-7-1-2-8-6(3-9(13)11(15)16)5-14-10(8)4-7/h1-2,4-5,9,14H,3H2,(H,15,16) |
| InChIKey | ABEUNVGCOMGKGF-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 53.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.56 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|