C15H23ClN2O2 — CID 145142461
2-amino-3-(6-chloro-1H-indol-3-yl)propanoic acid;ethane (PubChem CID 145142461) has the molecular formula C15H23ClN2O2 and a molecular weight of 298.81 g/mol. Its IUPAC name is 2-amino-3-(6-chloro-1H-indol-3-yl)propanoic acid;ethane.
| Compound Name | 2-amino-3-(6-chloro-1H-indol-3-yl)propanoic acid;ethane |
|---|---|
| PubChem CID | 145142461 |
| Molecular Formula | C15H23ClN2O2 |
| Molecular Weight | 298.81 g/mol |
| Exact Mass | 298.14 |
| IUPAC Name | 2-amino-3-(6-chloro-1H-indol-3-yl)propanoic acid;ethane |
| SMILES | CC.CC.NC(Cc1c[nH]c2cc(Cl)ccc12)C(=O)O |
| InChI | InChI=1S/C11H11ClN2O2.2C2H6/c12-7-1-2-8-6(3-9(13)11(15)16)5-14-10(8)4-7;2*1-2/h1-2,4-5,9,14H,3,13H2,(H,15,16);2*1-2H3 |
| InChIKey | WJFKYGPMTLRGOW-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 79.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.81 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |