C14H20N2O2 — CID 145142449
2-amino-3-(5-methyl-1H-indol-3-yl)propanoic acid;ethane (PubChem CID 145142449) has the molecular formula C14H20N2O2 and a molecular weight of 248.33 g/mol. Its IUPAC name is 2-amino-3-(5-methyl-1H-indol-3-yl)propanoic acid;ethane.
| Compound Name | 2-amino-3-(5-methyl-1H-indol-3-yl)propanoic acid;ethane |
|---|---|
| PubChem CID | 145142449 |
| Molecular Formula | C14H20N2O2 |
| Molecular Weight | 248.33 g/mol |
| Exact Mass | 248.15 |
| IUPAC Name | 2-amino-3-(5-methyl-1H-indol-3-yl)propanoic acid;ethane |
| SMILES | CC.Cc1ccc2[nH]cc(CC(N)C(=O)O)c2c1 |
| InChI | InChI=1S/C12H14N2O2.C2H6/c1-7-2-3-11-9(4-7)8(6-14-11)5-10(13)12(15)16;1-2/h2-4,6,10,14H,5,13H2,1H3,(H,15,16);1-2H3 |
| InChIKey | HBEBJHPTOFXFPF-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 79.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.33 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |