C11H11N3O3 — CID 174880510
(2S)-2-amino-3-(5-nitroso-1H-indol-3-yl)propanoic acid (PubChem CID 174880510) has the molecular formula C11H11N3O3 and a molecular weight of 233.23 g/mol. Its IUPAC name is (2S)-2-amino-3-(5-nitroso-1H-indol-3-yl)propanoic acid.
| Compound Name | (2S)-2-amino-3-(5-nitroso-1H-indol-3-yl)propanoic acid |
|---|---|
| PubChem CID | 174880510 |
| Molecular Formula | C11H11N3O3 |
| Molecular Weight | 233.23 g/mol |
| Exact Mass | 233.08 |
| IUPAC Name | (2S)-2-amino-3-(5-nitroso-1H-indol-3-yl)propanoic acid |
| SMILES | N[C@@H](Cc1c[nH]c2ccc(N=O)cc12)C(=O)O |
| InChI | InChI=1S/C11H11N3O3/c12-9(11(15)16)3-6-5-13-10-2-1-7(14-17)4-8(6)10/h1-2,4-5,9,13H,3,12H2,(H,15,16)/t9-/m0/s1 |
| InChIKey | AZDYVNZLLKZTLR-VIFPVBQESA-N |
| XLogP | 1.52 |
| TPSA | 108.54 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.23 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |