C12H12N2O4 — CID 22669189
3-(2-amino-2-carboxyethyl)-1H-indole-5-carboxylic acid (PubChem CID 22669189) has the molecular formula C12H12N2O4 and a molecular weight of 248.24 g/mol. Its IUPAC name is 3-(2-amino-2-carboxyethyl)-1H-indole-5-carboxylic acid.
| Compound Name | 3-(2-amino-2-carboxyethyl)-1H-indole-5-carboxylic acid |
|---|---|
| PubChem CID | 22669189 |
| Molecular Formula | C12H12N2O4 |
| Molecular Weight | 248.24 g/mol |
| Exact Mass | 248.08 |
| IUPAC Name | 3-(2-amino-2-carboxyethyl)-1H-indole-5-carboxylic acid |
| SMILES | NC(Cc1c[nH]c2ccc(C(=O)O)cc12)C(=O)O |
| InChI | InChI=1S/C12H12N2O4/c13-9(12(17)18)4-7-5-14-10-2-1-6(11(15)16)3-8(7)10/h1-3,5,9,14H,4,13H2,(H,15,16)(H,17,18) |
| InChIKey | MYWSUGQAYVCXSM-UHFFFAOYSA-N |
| XLogP | 0.82 |
| TPSA | 116.41 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.24 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |