C16H20N2O2 — CID 164588463
2-amino-3-[6-(3-methylbut-2-enyl)-1H-indol-3-yl]propanoic acid (PubChem CID 164588463) has the molecular formula C16H20N2O2 and a molecular weight of 272.35 g/mol. Its IUPAC name is 2-amino-3-[6-(3-methylbut-2-enyl)-1H-indol-3-yl]propanoic acid.
| Compound Name | 2-amino-3-[6-(3-methylbut-2-enyl)-1H-indol-3-yl]propanoic acid |
|---|---|
| PubChem CID | 164588463 |
| Molecular Formula | C16H20N2O2 |
| Molecular Weight | 272.35 g/mol |
| Exact Mass | 272.15 |
| IUPAC Name | 2-amino-3-[6-(3-methylbut-2-enyl)-1H-indol-3-yl]propanoic acid |
| SMILES | CC(C)=CCc1ccc2c(CC(N)C(=O)O)c[nH]c2c1 |
| InChI | InChI=1S/C16H20N2O2/c1-10(2)3-4-11-5-6-13-12(8-14(17)16(19)20)9-18-15(13)7-11/h3,5-7,9,14,18H,4,8,17H2,1-2H3,(H,19,20) |
| InChIKey | XPUOGJPNKWDYTE-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 79.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.35 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|