C16H22N2 — CID 170014024
1-[6-(3-methylbut-2-enyl)-1H-indol-3-yl]propan-2-amine (PubChem CID 170014024) has the molecular formula C16H22N2 and a molecular weight of 242.37 g/mol. Its IUPAC name is 1-[6-(3-methylbut-2-enyl)-1H-indol-3-yl]propan-2-amine.
| Compound Name | 1-[6-(3-methylbut-2-enyl)-1H-indol-3-yl]propan-2-amine |
|---|---|
| PubChem CID | 170014024 |
| Molecular Formula | C16H22N2 |
| Molecular Weight | 242.37 g/mol |
| Exact Mass | 242.18 |
| IUPAC Name | 1-[6-(3-methylbut-2-enyl)-1H-indol-3-yl]propan-2-amine |
| SMILES | CC(C)=CCc1ccc2c(CC(C)N)c[nH]c2c1 |
| InChI | InChI=1S/C16H22N2/c1-11(2)4-5-13-6-7-15-14(8-12(3)17)10-18-16(15)9-13/h4,6-7,9-10,12,18H,5,8,17H2,1-3H3 |
| InChIKey | ZAGULOHWGWYABC-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 41.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.37 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|