C17H23Cl2N3O4 — CID 54609543
acetic acid;2-amino-3-[6-[bis(2-chloroethyl)amino]-1H-indol-3-yl]propanoic acid (PubChem CID 54609543) has the molecular formula C17H23Cl2N3O4 and a molecular weight of 404.29 g/mol. Its IUPAC name is acetic acid;2-amino-3-[6-[bis(2-chloroethyl)amino]-1H-indol-3-yl]propanoic acid.
| Compound Name | acetic acid;2-amino-3-[6-[bis(2-chloroethyl)amino]-1H-indol-3-yl]propanoic acid |
|---|---|
| PubChem CID | 54609543 |
| Molecular Formula | C17H23Cl2N3O4 |
| Molecular Weight | 404.29 g/mol |
| Exact Mass | 403.11 |
| IUPAC Name | acetic acid;2-amino-3-[6-[bis(2-chloroethyl)amino]-1H-indol-3-yl]propanoic acid |
| SMILES | CC(=O)O.NC(Cc1c[nH]c2cc(N(CCCl)CCCl)ccc12)C(=O)O |
| InChI | InChI=1S/C15H19Cl2N3O2.C2H4O2/c16-3-5-20(6-4-17)11-1-2-12-10(7-13(18)15(21)22)9-19-14(12)8-11;1-2(3)4/h1-2,8-9,13,19H,3-7,18H2,(H,21,22);1H3,(H,3,4) |
| InChIKey | JCLQAHAFPAALLR-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 119.65 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.29 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|