C16H15ClN4O3 — CID 167791913
2-[[2-(6-chloro-1H-indol-3-yl)acetyl]amino]-2-(2-methylpyrazol-3-yl)acetic acid (PubChem CID 167791913) has the molecular formula C16H15ClN4O3 and a molecular weight of 346.77 g/mol. Its IUPAC name is 2-[[2-(6-chloro-1H-indol-3-yl)acetyl]amino]-2-(2-methylpyrazol-3-yl)acetic acid.
| Compound Name | 2-[[2-(6-chloro-1H-indol-3-yl)acetyl]amino]-2-(2-methylpyrazol-3-yl)acetic acid |
|---|---|
| PubChem CID | 167791913 |
| Molecular Formula | C16H15ClN4O3 |
| Molecular Weight | 346.77 g/mol |
| Exact Mass | 346.08 |
| IUPAC Name | 2-[[2-(6-chloro-1H-indol-3-yl)acetyl]amino]-2-(2-methylpyrazol-3-yl)acetic acid |
| SMILES | Cn1nccc1C(NC(=O)Cc1c[nH]c2cc(Cl)ccc12)C(=O)O |
| InChI | InChI=1S/C16H15ClN4O3/c1-21-13(4-5-19-21)15(16(23)24)20-14(22)6-9-8-18-12-7-10(17)2-3-11(9)12/h2-5,7-8,15,18H,6H2,1H3,(H,20,22)(H,23,24) |
| InChIKey | DRCWZEKSMRKZGN-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 100.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.77 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |