C27H22ClNO4 — CID 158080302
(2R)-2-[(6-chloro-1H-indol-3-yl)methyl]-4-(9H-fluoren-9-ylmethoxy)-4-oxobutanoic acid (PubChem CID 158080302) has the molecular formula C27H22ClNO4 and a molecular weight of 459.93 g/mol. Its IUPAC name is (2R)-2-[(6-chloro-1H-indol-3-yl)methyl]-4-(9H-fluoren-9-ylmethoxy)-4-oxobutanoic acid.
| Compound Name | (2R)-2-[(6-chloro-1H-indol-3-yl)methyl]-4-(9H-fluoren-9-ylmethoxy)-4-oxobutanoic acid |
|---|---|
| PubChem CID | 158080302 |
| Molecular Formula | C27H22ClNO4 |
| Molecular Weight | 459.93 g/mol |
| Exact Mass | 459.12 |
| IUPAC Name | (2R)-2-[(6-chloro-1H-indol-3-yl)methyl]-4-(9H-fluoren-9-ylmethoxy)-4-oxobutanoic acid |
| SMILES | O=C(CC(Cc1c[nH]c2cc(Cl)ccc12)C(=O)O)OCC1c2ccccc2-c2ccccc21 |
| InChI | InChI=1S/C27H22ClNO4/c28-18-9-10-19-17(14-29-25(19)13-18)11-16(27(31)32)12-26(30)33-15-24-22-7-3-1-5-20(22)21-6-2-4-8-23(21)24/h1-10,13-14,16,24,29H,11-12,15H2,(H,31,32) |
| InChIKey | FMWJQIVTZPHJEQ-UHFFFAOYSA-N |
| XLogP | 5.81 |
| TPSA | 79.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.93 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |