C28H26N2O4 — CID 57355811
(2R)-4-amino-2-(9H-fluoren-9-ylmethoxycarbonyl)-5-(1H-indol-3-yl)pentanoic acid (PubChem CID 57355811) has the molecular formula C28H26N2O4 and a molecular weight of 454.53 g/mol. Its IUPAC name is (2R)-4-amino-2-(9H-fluoren-9-ylmethoxycarbonyl)-5-(1H-indol-3-yl)pentanoic acid.
| Compound Name | (2R)-4-amino-2-(9H-fluoren-9-ylmethoxycarbonyl)-5-(1H-indol-3-yl)pentanoic acid |
|---|---|
| PubChem CID | 57355811 |
| Molecular Formula | C28H26N2O4 |
| Molecular Weight | 454.53 g/mol |
| Exact Mass | 454.19 |
| IUPAC Name | (2R)-4-amino-2-(9H-fluoren-9-ylmethoxycarbonyl)-5-(1H-indol-3-yl)pentanoic acid |
| SMILES | NC(Cc1c[nH]c2ccccc12)C[C@H](C(=O)O)C(=O)OCC1c2ccccc2-c2ccccc21 |
| InChI | InChI=1S/C28H26N2O4/c29-18(13-17-15-30-26-12-6-5-7-19(17)26)14-24(27(31)32)28(33)34-16-25-22-10-3-1-8-20(22)21-9-2-4-11-23(21)25/h1-12,15,18,24-25,30H,13-14,16,29H2,(H,31,32)/t18?,24-/m1/s1 |
| InChIKey | NDBHFZVPJGIXRD-VCUSLETLSA-N |
| XLogP | 4.48 |
| TPSA | 105.41 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.53 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|