C27H20N2O5 — CID 165340462
9H-fluoren-9-ylmethyl (4S)-4-(1H-indol-3-ylmethyl)-2,5-dioxo-1,3-oxazolidine-3-carboxylate (PubChem CID 165340462) has the molecular formula C27H20N2O5 and a molecular weight of 452.47 g/mol. Its IUPAC name is 9H-fluoren-9-ylmethyl (4S)-4-(1H-indol-3-ylmethyl)-2,5-dioxo-1,3-oxazolidine-3-carboxylate.
| Compound Name | 9H-fluoren-9-ylmethyl (4S)-4-(1H-indol-3-ylmethyl)-2,5-dioxo-1,3-oxazolidine-3-carboxylate |
|---|---|
| PubChem CID | 165340462 |
| Molecular Formula | C27H20N2O5 |
| Molecular Weight | 452.47 g/mol |
| Exact Mass | 452.14 |
| IUPAC Name | 9H-fluoren-9-ylmethyl (4S)-4-(1H-indol-3-ylmethyl)-2,5-dioxo-1,3-oxazolidine-3-carboxylate |
| SMILES | O=C1OC(=O)N(C(=O)OCC2c3ccccc3-c3ccccc32)[C@H]1Cc1c[nH]c2ccccc12 |
| InChI | InChI=1S/C27H20N2O5/c30-25-24(13-16-14-28-23-12-6-5-7-17(16)23)29(27(32)34-25)26(31)33-15-22-20-10-3-1-8-18(20)19-9-2-4-11-21(19)22/h1-12,14,22,24,28H,13,15H2/t24-/m0/s1 |
| InChIKey | LNVWJPHAVCIRIZ-DEOSSOPVSA-N |
| XLogP | 5.01 |
| TPSA | 88.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.47 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|