C9H9N2O5P — CID 67724966
(6-carbamoyl-1H-indol-3-yl) dihydrogen phosphate (PubChem CID 67724966) has the molecular formula C9H9N2O5P and a molecular weight of 256.15 g/mol. Its IUPAC name is (6-carbamoyl-1H-indol-3-yl) dihydrogen phosphate.
| Compound Name | (6-carbamoyl-1H-indol-3-yl) dihydrogen phosphate |
|---|---|
| PubChem CID | 67724966 |
| Molecular Formula | C9H9N2O5P |
| Molecular Weight | 256.15 g/mol |
| Exact Mass | 256.02 |
| IUPAC Name | (6-carbamoyl-1H-indol-3-yl) dihydrogen phosphate |
| SMILES | NC(=O)c1ccc2c(OP(=O)(O)O)c[nH]c2c1 |
| InChI | InChI=1S/C9H9N2O5P/c10-9(12)5-1-2-6-7(3-5)11-4-8(6)16-17(13,14)15/h1-4,11H,(H2,10,12)(H2,13,14,15) |
| InChIKey | MBNQTIIMDGHXNL-UHFFFAOYSA-N |
| XLogP | 0.74 |
| TPSA | 125.64 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.15 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|