About lithium;(2-aminophenyl) dihydrogen phosphate;hydride
lithium;(2-aminophenyl) dihydrogen phosphate;hydride (PubChem CID 175194411) has the molecular formula C6H9LiNO4P
and a molecular weight of 197.06 g/mol. Its IUPAC name is lithium;(2-aminophenyl) dihydrogen phosphate;hydride.
Molecular Properties
| Compound Name | lithium;(2-aminophenyl) dihydrogen phosphate;hydride |
| PubChem CID | 175194411 |
| Molecular Formula | C6H9LiNO4P |
| Molecular Weight | 197.06 g/mol |
| Exact Mass | 197.04 |
| IUPAC Name | lithium;(2-aminophenyl) dihydrogen phosphate;hydride |
| SMILES | Nc1ccccc1OP(=O)(O)O.[H-].[Li+] |
| InChI | InChI=1S/C6H8NO4P.Li.H/c7-5-3-1-2-4-6(5)11-12(8,9)10;;/h1-4H,7H2,(H2,8,9,10);;/q;+1;-1 |
| InChIKey | MQQAUOMKXGJQIX-UHFFFAOYSA-N |
| XLogP | -2.14 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 197.06 |
| LogP ≤ 5 | -2.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze lithium;(2-aminophenyl) dihydrogen phosphate;hydride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of lithium;(2-aminophenyl) dihydrogen phosphate;hydride?
The IUPAC name of lithium;(2-aminophenyl) dihydrogen phosphate;hydride (CID 175194411) is lithium;(2-aminophenyl) dihydrogen phosphate;hydride.
What is the SMILES notation for lithium;(2-aminophenyl) dihydrogen phosphate;hydride?
The canonical SMILES for lithium;(2-aminophenyl) dihydrogen phosphate;hydride is Nc1ccccc1OP(=O)(O)O.[H-].[Li+].
What is the InChIKey of lithium;(2-aminophenyl) dihydrogen phosphate;hydride?
The InChIKey is MQQAUOMKXGJQIX-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H8NO4P.Li.H/c7-5-3-1-2-4-6(5)11-12(8,9)10;;/h1-4H,7H2,(H2,8,9,10);;/q;+1;-1.
What are the key properties of lithium;(2-aminophenyl) dihydrogen phosphate;hydride?
lithium;(2-aminophenyl) dihydrogen phosphate;hydride has a molecular weight of 197.06 g/mol, XLogP of -2.14, 2 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for lithium;(2-aminophenyl) dihydrogen phosphate;hydride is sourced from PubChem (CID 175194411), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).