About sodium;hydride;2-phosphonooxybenzoic acid
sodium;hydride;2-phosphonooxybenzoic acid (PubChem CID 174241105) has the molecular formula C7H8NaO6P
and a molecular weight of 242.10 g/mol. Its IUPAC name is sodium;hydride;2-phosphonooxybenzoic acid.
Molecular Properties
| Compound Name | sodium;hydride;2-phosphonooxybenzoic acid |
| PubChem CID | 174241105 |
| Molecular Formula | C7H8NaO6P |
| Molecular Weight | 242.10 g/mol |
| Exact Mass | 242.00 |
| IUPAC Name | sodium;hydride;2-phosphonooxybenzoic acid |
| SMILES | O=C(O)c1ccccc1OP(=O)(O)O.[H-].[Na+] |
| InChI | InChI=1S/C7H7O6P.Na.H/c8-7(9)5-3-1-2-4-6(5)13-14(10,11)12;;/h1-4H,(H,8,9)(H2,10,11,12);;/q;+1;-1 |
| InChIKey | IJAPZJPYHIIVPA-UHFFFAOYSA-N |
| XLogP | -2.03 |
| TPSA | 104.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 242.10 |
| LogP ≤ 5 | -2.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze sodium;hydride;2-phosphonooxybenzoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sodium;hydride;2-phosphonooxybenzoic acid?
The IUPAC name of sodium;hydride;2-phosphonooxybenzoic acid (CID 174241105) is sodium;hydride;2-phosphonooxybenzoic acid.
What is the SMILES notation for sodium;hydride;2-phosphonooxybenzoic acid?
The canonical SMILES for sodium;hydride;2-phosphonooxybenzoic acid is O=C(O)c1ccccc1OP(=O)(O)O.[H-].[Na+].
What is the InChIKey of sodium;hydride;2-phosphonooxybenzoic acid?
The InChIKey is IJAPZJPYHIIVPA-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H7O6P.Na.H/c8-7(9)5-3-1-2-4-6(5)13-14(10,11)12;;/h1-4H,(H,8,9)(H2,10,11,12);;/q;+1;-1.
What are the key properties of sodium;hydride;2-phosphonooxybenzoic acid?
sodium;hydride;2-phosphonooxybenzoic acid has a molecular weight of 242.10 g/mol, XLogP of -2.03, 3 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for sodium;hydride;2-phosphonooxybenzoic acid is sourced from PubChem (CID 174241105), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).