About 2-acetyloxyethyl 2-phosphonooxybenzoate
2-acetyloxyethyl 2-phosphonooxybenzoate (PubChem CID 58511809) has the molecular formula C11H13O8P
and a molecular weight of 304.19 g/mol. Its IUPAC name is 2-acetyloxyethyl 2-phosphonooxybenzoate.
Molecular Properties
| Compound Name | 2-acetyloxyethyl 2-phosphonooxybenzoate |
| PubChem CID | 58511809 |
| Molecular Formula | C11H13O8P |
| Molecular Weight | 304.19 g/mol |
| Exact Mass | 304.03 |
| IUPAC Name | 2-acetyloxyethyl 2-phosphonooxybenzoate |
| SMILES | CC(=O)OCCOC(=O)c1ccccc1OP(=O)(O)O |
| InChI | InChI=1S/C11H13O8P/c1-8(12)17-6-7-18-11(13)9-4-2-3-5-10(9)19-20(14,15)16/h2-5H,6-7H2,1H3,(H2,14,15,16) |
| InChIKey | CAGLDDROOFRWQU-UHFFFAOYSA-N |
| XLogP | 0.88 |
| TPSA | 119.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 304.19 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze 2-acetyloxyethyl 2-phosphonooxybenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-acetyloxyethyl 2-phosphonooxybenzoate?
The IUPAC name of 2-acetyloxyethyl 2-phosphonooxybenzoate (CID 58511809) is 2-acetyloxyethyl 2-phosphonooxybenzoate.
What is the SMILES notation for 2-acetyloxyethyl 2-phosphonooxybenzoate?
The canonical SMILES for 2-acetyloxyethyl 2-phosphonooxybenzoate is CC(=O)OCCOC(=O)c1ccccc1OP(=O)(O)O.
What is the InChIKey of 2-acetyloxyethyl 2-phosphonooxybenzoate?
The InChIKey is CAGLDDROOFRWQU-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H13O8P/c1-8(12)17-6-7-18-11(13)9-4-2-3-5-10(9)19-20(14,15)16/h2-5H,6-7H2,1H3,(H2,14,15,16).
What are the key properties of 2-acetyloxyethyl 2-phosphonooxybenzoate?
2-acetyloxyethyl 2-phosphonooxybenzoate has a molecular weight of 304.19 g/mol, XLogP of 0.88, 6 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-acetyloxyethyl 2-phosphonooxybenzoate is sourced from PubChem (CID 58511809), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).