About carbonic acid;propyl 2-propoxybenzoate
carbonic acid;propyl 2-propoxybenzoate (PubChem CID 69345278) has the molecular formula C14H20O6
and a molecular weight of 284.31 g/mol. Its IUPAC name is carbonic acid;propyl 2-propoxybenzoate.
Molecular Properties
| Compound Name | carbonic acid;propyl 2-propoxybenzoate |
| PubChem CID | 69345278 |
| Molecular Formula | C14H20O6 |
| Molecular Weight | 284.31 g/mol |
| Exact Mass | 284.13 |
| IUPAC Name | carbonic acid;propyl 2-propoxybenzoate |
| SMILES | CCCOC(=O)c1ccccc1OCCC.O=C(O)O |
| InChI | InChI=1S/C13H18O3.CH2O3/c1-3-9-15-12-8-6-5-7-11(12)13(14)16-10-4-2;2-1(3)4/h5-8H,3-4,9-10H2,1-2H3;(H2,2,3,4) |
| InChIKey | SWOMHNKYMIZCSB-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 284.31 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze carbonic acid;propyl 2-propoxybenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of carbonic acid;propyl 2-propoxybenzoate?
The IUPAC name of carbonic acid;propyl 2-propoxybenzoate (CID 69345278) is carbonic acid;propyl 2-propoxybenzoate.
What is the SMILES notation for carbonic acid;propyl 2-propoxybenzoate?
The canonical SMILES for carbonic acid;propyl 2-propoxybenzoate is CCCOC(=O)c1ccccc1OCCC.O=C(O)O.
What is the InChIKey of carbonic acid;propyl 2-propoxybenzoate?
The InChIKey is SWOMHNKYMIZCSB-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H18O3.CH2O3/c1-3-9-15-12-8-6-5-7-11(12)13(14)16-10-4-2;2-1(3)4/h5-8H,3-4,9-10H2,1-2H3;(H2,2,3,4).
What are the key properties of carbonic acid;propyl 2-propoxybenzoate?
carbonic acid;propyl 2-propoxybenzoate has a molecular weight of 284.31 g/mol, XLogP of 3.26, 6 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for carbonic acid;propyl 2-propoxybenzoate is sourced from PubChem (CID 69345278), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).