About propyl 2-propan-2-yloxybenzoate
propyl 2-propan-2-yloxybenzoate (PubChem CID 82186328) has the molecular formula C13H18O3
and a molecular weight of 222.28 g/mol. Its IUPAC name is propyl 2-propan-2-yloxybenzoate.
Molecular Properties
| Compound Name | propyl 2-propan-2-yloxybenzoate |
| PubChem CID | 82186328 |
| Molecular Formula | C13H18O3 |
| Molecular Weight | 222.28 g/mol |
| Exact Mass | 222.13 |
| IUPAC Name | propyl 2-propan-2-yloxybenzoate |
| SMILES | CCCOC(=O)c1ccccc1OC(C)C |
| InChI | InChI=1S/C13H18O3/c1-4-9-15-13(14)11-7-5-6-8-12(11)16-10(2)3/h5-8,10H,4,9H2,1-3H3 |
| InChIKey | PXHTZBZPZNXCFW-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 222.28 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze propyl 2-propan-2-yloxybenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of propyl 2-propan-2-yloxybenzoate?
The IUPAC name of propyl 2-propan-2-yloxybenzoate (CID 82186328) is propyl 2-propan-2-yloxybenzoate.
What is the SMILES notation for propyl 2-propan-2-yloxybenzoate?
The canonical SMILES for propyl 2-propan-2-yloxybenzoate is CCCOC(=O)c1ccccc1OC(C)C.
What is the InChIKey of propyl 2-propan-2-yloxybenzoate?
The InChIKey is PXHTZBZPZNXCFW-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H18O3/c1-4-9-15-13(14)11-7-5-6-8-12(11)16-10(2)3/h5-8,10H,4,9H2,1-3H3.
What are the key properties of propyl 2-propan-2-yloxybenzoate?
propyl 2-propan-2-yloxybenzoate has a molecular weight of 222.28 g/mol, XLogP of 3.04, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for propyl 2-propan-2-yloxybenzoate is sourced from PubChem (CID 82186328), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).