About 2-phenylethyl 2-butoxybenzoate
2-phenylethyl 2-butoxybenzoate (PubChem CID 141306389) has the molecular formula C19H22O3
and a molecular weight of 298.38 g/mol. Its IUPAC name is 2-phenylethyl 2-butoxybenzoate.
Molecular Properties
| Compound Name | 2-phenylethyl 2-butoxybenzoate |
| PubChem CID | 141306389 |
| Molecular Formula | C19H22O3 |
| Molecular Weight | 298.38 g/mol |
| Exact Mass | 298.16 |
| IUPAC Name | 2-phenylethyl 2-butoxybenzoate |
| SMILES | CCCCOc1ccccc1C(=O)OCCc1ccccc1 |
| InChI | InChI=1S/C19H22O3/c1-2-3-14-21-18-12-8-7-11-17(18)19(20)22-15-13-16-9-5-4-6-10-16/h4-12H,2-3,13-15H2,1H3 |
| InChIKey | YYRYFZGQRVAHFP-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 298.38 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-phenylethyl 2-butoxybenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-phenylethyl 2-butoxybenzoate?
The IUPAC name of 2-phenylethyl 2-butoxybenzoate (CID 141306389) is 2-phenylethyl 2-butoxybenzoate.
What is the SMILES notation for 2-phenylethyl 2-butoxybenzoate?
The canonical SMILES for 2-phenylethyl 2-butoxybenzoate is CCCCOc1ccccc1C(=O)OCCc1ccccc1.
What is the InChIKey of 2-phenylethyl 2-butoxybenzoate?
The InChIKey is YYRYFZGQRVAHFP-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H22O3/c1-2-3-14-21-18-12-8-7-11-17(18)19(20)22-15-13-16-9-5-4-6-10-16/h4-12H,2-3,13-15H2,1H3.
What are the key properties of 2-phenylethyl 2-butoxybenzoate?
2-phenylethyl 2-butoxybenzoate has a molecular weight of 298.38 g/mol, XLogP of 4.26, 8 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-phenylethyl 2-butoxybenzoate is sourced from PubChem (CID 141306389), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).