C6H8NO6PS — CID 154197376
(2-sulfamoylphenyl) dihydrogen phosphate (PubChem CID 154197376) has the molecular formula C6H8NO6PS and a molecular weight of 253.17 g/mol. Its IUPAC name is (2-sulfamoylphenyl) dihydrogen phosphate.
| Compound Name | (2-sulfamoylphenyl) dihydrogen phosphate |
|---|---|
| PubChem CID | 154197376 |
| Molecular Formula | C6H8NO6PS |
| Molecular Weight | 253.17 g/mol |
| Exact Mass | 252.98 |
| IUPAC Name | (2-sulfamoylphenyl) dihydrogen phosphate |
| SMILES | NS(=O)(=O)c1ccccc1OP(=O)(O)O |
| InChI | InChI=1S/C6H8NO6PS/c7-15(11,12)6-4-2-1-3-5(6)13-14(8,9)10/h1-4H,(H2,7,11,12)(H2,8,9,10) |
| InChIKey | DGZPDMMEMDFMLY-UHFFFAOYSA-N |
| XLogP | -0.19 |
| TPSA | 126.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.17 |
| LogP ≤ 5 | -0.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|