About disodium;1H-indol-3-yl [1H-indol-3-yloxy(oxido)phosphoryl] phosphate
disodium;1H-indol-3-yl [1H-indol-3-yloxy(oxido)phosphoryl] phosphate (PubChem CID 16666794) has the molecular formula C16H12N2Na2O7P2
and a molecular weight of 452.21 g/mol. Its IUPAC name is disodium;1H-indol-3-yl [1H-indol-3-yloxy(oxido)phosphoryl] phosphate.
Molecular Properties
| Compound Name | disodium;1H-indol-3-yl [1H-indol-3-yloxy(oxido)phosphoryl] phosphate |
| PubChem CID | 16666794 |
| Molecular Formula | C16H12N2Na2O7P2 |
| Molecular Weight | 452.21 g/mol |
| Exact Mass | 451.99 |
| IUPAC Name | disodium;1H-indol-3-yl [1H-indol-3-yloxy(oxido)phosphoryl] phosphate |
| SMILES | O=P([O-])(Oc1c[nH]c2ccccc12)OP(=O)([O-])Oc1c[nH]c2ccccc12.[Na+].[Na+] |
| InChI | InChI=1S/C16H14N2O7P2.2Na/c19-26(20,23-15-9-17-13-7-3-1-5-11(13)15)25-27(21,22)24-16-10-18-14-8-4-2-6-12(14)16;;/h1-10,17-18H,(H,19,20)(H,21,22);;/q;2*+1/p-2 |
| InChIKey | LQFPZGSFGJVMKZ-UHFFFAOYSA-L |
| XLogP | -2.93 |
| TPSA | 139.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 452.21 |
| LogP ≤ 5 | -2.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze disodium;1H-indol-3-yl [1H-indol-3-yloxy(oxido)phosphoryl] phosphate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of disodium;1H-indol-3-yl [1H-indol-3-yloxy(oxido)phosphoryl] phosphate?
The IUPAC name of disodium;1H-indol-3-yl [1H-indol-3-yloxy(oxido)phosphoryl] phosphate (CID 16666794) is disodium;1H-indol-3-yl [1H-indol-3-yloxy(oxido)phosphoryl] phosphate.
What is the SMILES notation for disodium;1H-indol-3-yl [1H-indol-3-yloxy(oxido)phosphoryl] phosphate?
The canonical SMILES for disodium;1H-indol-3-yl [1H-indol-3-yloxy(oxido)phosphoryl] phosphate is O=P([O-])(Oc1c[nH]c2ccccc12)OP(=O)([O-])Oc1c[nH]c2ccccc12.[Na+].[Na+].
What is the InChIKey of disodium;1H-indol-3-yl [1H-indol-3-yloxy(oxido)phosphoryl] phosphate?
The InChIKey is LQFPZGSFGJVMKZ-UHFFFAOYSA-L. The full InChI is InChI=1S/C16H14N2O7P2.2Na/c19-26(20,23-15-9-17-13-7-3-1-5-11(13)15)25-27(21,22)24-16-10-18-14-8-4-2-6-12(14)16;;/h1-10,17-18H,(H,19,20)(H,21,22);;/q;2*+1/p-2.
What are the key properties of disodium;1H-indol-3-yl [1H-indol-3-yloxy(oxido)phosphoryl] phosphate?
disodium;1H-indol-3-yl [1H-indol-3-yloxy(oxido)phosphoryl] phosphate has a molecular weight of 452.21 g/mol, XLogP of -2.93, 6 rotatable bonds, 2 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for disodium;1H-indol-3-yl [1H-indol-3-yloxy(oxido)phosphoryl] phosphate is sourced from PubChem (CID 16666794), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).