C14H16BrClNO10P — CID 20652950
[(1S,2R,3R,4R,5R,6S)-3-bromo-4-chloro-1,2,3,4,5,6-hexahydroxycyclohexyl] 1H-indol-3-yl hydrogen phosphate (PubChem CID 20652950) has the molecular formula C14H16BrClNO10P and a molecular weight of 504.61 g/mol. Its IUPAC name is [(1S,2R,3R,4R,5R,6S)-3-bromo-4-chloro-1,2,3,4,5,6-hexahydroxycyclohexyl] 1H-indol-3-yl hydrogen phosphate.
| Compound Name | [(1S,2R,3R,4R,5R,6S)-3-bromo-4-chloro-1,2,3,4,5,6-hexahydroxycyclohexyl] 1H-indol-3-yl hydrogen phosphate |
|---|---|
| PubChem CID | 20652950 |
| Molecular Formula | C14H16BrClNO10P |
| Molecular Weight | 504.61 g/mol |
| Exact Mass | 502.94 |
| IUPAC Name | [(1S,2R,3R,4R,5R,6S)-3-bromo-4-chloro-1,2,3,4,5,6-hexahydroxycyclohexyl] 1H-indol-3-yl hydrogen phosphate |
| SMILES | O=P(O)(Oc1c[nH]c2ccccc12)O[C@]1(O)[C@@H](O)[C@@](O)(Br)[C@](O)(Cl)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C14H16BrClNO10P/c15-13(22)11(20)12(21,9(18)10(19)14(13,16)23)27-28(24,25)26-8-5-17-7-4-2-1-3-6(7)8/h1-5,9-11,17-23H,(H,24,25)/t9-,10+,11+,12-,13-,14-/m0/s1 |
| InChIKey | KJJFHQNEJLQZKP-KTEZLCCFSA-N |
| XLogP | -0.54 |
| TPSA | 192.93 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.61 |
| LogP ≤ 5 | -0.54 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|