C14H17ClNO9P — CID 174748431
[(1S,2S,3R,4R,5S,6R)-3-chloro-1,2,3,4,5,6-hexahydroxy-5-(1H-indol-3-yl)cyclohexyl]phosphonic acid (PubChem CID 174748431) has the molecular formula C14H17ClNO9P and a molecular weight of 409.72 g/mol. Its IUPAC name is [(1S,2S,3R,4R,5S,6R)-3-chloro-1,2,3,4,5,6-hexahydroxy-5-(1H-indol-3-yl)cyclohexyl]phosphonic acid.
| Compound Name | [(1S,2S,3R,4R,5S,6R)-3-chloro-1,2,3,4,5,6-hexahydroxy-5-(1H-indol-3-yl)cyclohexyl]phosphonic acid |
|---|---|
| PubChem CID | 174748431 |
| Molecular Formula | C14H17ClNO9P |
| Molecular Weight | 409.72 g/mol |
| Exact Mass | 409.03 |
| IUPAC Name | [(1S,2S,3R,4R,5S,6R)-3-chloro-1,2,3,4,5,6-hexahydroxy-5-(1H-indol-3-yl)cyclohexyl]phosphonic acid |
| SMILES | O=P(O)(O)[C@]1(O)[C@H](O)[C@](O)(Cl)[C@H](O)[C@](O)(c2c[nH]c3ccccc23)[C@H]1O |
| InChI | InChI=1S/C14H17ClNO9P/c15-13(21)9(17)12(20,7-5-16-8-4-2-1-3-6(7)8)10(18)14(22,11(13)19)26(23,24)25/h1-5,9-11,16-22H,(H2,23,24,25)/t9-,10-,11-,12-,13+,14+/m1/s1 |
| InChIKey | KZCPZAPPOUMANF-KJKVDNPUSA-N |
| XLogP | -1.75 |
| TPSA | 194.70 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.72 |
| LogP ≤ 5 | -1.75 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|