C14H16ClNO6 — CID 57265409
(2S,3R,4S,5S,6S)-6-[chloro(hydroxy)methyl]-4-(1H-indol-3-yl)oxane-2,3,4,5-tetrol (PubChem CID 57265409) has the molecular formula C14H16ClNO6 and a molecular weight of 329.74 g/mol. Its IUPAC name is (2S,3R,4S,5S,6S)-6-[chloro(hydroxy)methyl]-4-(1H-indol-3-yl)oxane-2,3,4,5-tetrol.
| Compound Name | (2S,3R,4S,5S,6S)-6-[chloro(hydroxy)methyl]-4-(1H-indol-3-yl)oxane-2,3,4,5-tetrol |
|---|---|
| PubChem CID | 57265409 |
| Molecular Formula | C14H16ClNO6 |
| Molecular Weight | 329.74 g/mol |
| Exact Mass | 329.07 |
| IUPAC Name | (2S,3R,4S,5S,6S)-6-[chloro(hydroxy)methyl]-4-(1H-indol-3-yl)oxane-2,3,4,5-tetrol |
| SMILES | OC(Cl)C1O[C@H](O)[C@H](O)[C@](O)(c2c[nH]c3ccccc23)[C@H]1O |
| InChI | InChI=1S/C14H16ClNO6/c15-12(19)9-10(17)14(21,11(18)13(20)22-9)7-5-16-8-4-2-1-3-6(7)8/h1-5,9-13,16-21H/t9?,10-,11-,12?,13-,14-/m0/s1 |
| InChIKey | LEZROCLGSIHXPN-IVIZWCMDSA-N |
| XLogP | -0.65 |
| TPSA | 126.17 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.74 |
| LogP ≤ 5 | -0.65 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|