C20H20ClNO6 — CID 66644513
(2S,3R,4S,5R,6S)-6-[chloro(hydroxy)methyl]-2-(1H-indol-3-yl)-2-phenoxyoxane-3,4,5-triol (PubChem CID 66644513) has the molecular formula C20H20ClNO6 and a molecular weight of 405.83 g/mol. Its IUPAC name is (2S,3R,4S,5R,6S)-6-[chloro(hydroxy)methyl]-2-(1H-indol-3-yl)-2-phenoxyoxane-3,4,5-triol.
| Compound Name | (2S,3R,4S,5R,6S)-6-[chloro(hydroxy)methyl]-2-(1H-indol-3-yl)-2-phenoxyoxane-3,4,5-triol |
|---|---|
| PubChem CID | 66644513 |
| Molecular Formula | C20H20ClNO6 |
| Molecular Weight | 405.83 g/mol |
| Exact Mass | 405.10 |
| IUPAC Name | (2S,3R,4S,5R,6S)-6-[chloro(hydroxy)methyl]-2-(1H-indol-3-yl)-2-phenoxyoxane-3,4,5-triol |
| SMILES | OC(Cl)[C@H]1O[C@](Oc2ccccc2)(c2c[nH]c3ccccc23)[C@H](O)[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C20H20ClNO6/c21-19(26)17-15(23)16(24)18(25)20(28-17,27-11-6-2-1-3-7-11)13-10-22-14-9-5-4-8-12(13)14/h1-10,15-19,22-26H/t15-,16+,17+,18-,19?,20-/m1/s1 |
| InChIKey | PLAOFJOLHFVALL-ZGXIQGQBSA-N |
| XLogP | 1.44 |
| TPSA | 115.17 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.83 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|