C20H23BrClNO7 — CID 166757391
cyclohexyl (2S,3R,4R,5R,6R)-5-bromo-4-chloro-3,4,5,6-tetrahydroxy-3-(1H-indol-3-yl)oxane-2-carboxylate (PubChem CID 166757391) has the molecular formula C20H23BrClNO7 and a molecular weight of 504.76 g/mol. Its IUPAC name is cyclohexyl (2S,3R,4R,5R,6R)-5-bromo-4-chloro-3,4,5,6-tetrahydroxy-3-(1H-indol-3-yl)oxane-2-carboxylate.
| Compound Name | cyclohexyl (2S,3R,4R,5R,6R)-5-bromo-4-chloro-3,4,5,6-tetrahydroxy-3-(1H-indol-3-yl)oxane-2-carboxylate |
|---|---|
| PubChem CID | 166757391 |
| Molecular Formula | C20H23BrClNO7 |
| Molecular Weight | 504.76 g/mol |
| Exact Mass | 503.03 |
| IUPAC Name | cyclohexyl (2S,3R,4R,5R,6R)-5-bromo-4-chloro-3,4,5,6-tetrahydroxy-3-(1H-indol-3-yl)oxane-2-carboxylate |
| SMILES | O=C(OC1CCCCC1)[C@H]1O[C@@H](O)[C@@](O)(Br)[C@](O)(Cl)[C@@]1(O)c1c[nH]c2ccccc12 |
| InChI | InChI=1S/C20H23BrClNO7/c21-19(27)17(25)30-15(16(24)29-11-6-2-1-3-7-11)18(26,20(19,22)28)13-10-23-14-9-5-4-8-12(13)14/h4-5,8-11,15,17,23,25-28H,1-3,6-7H2/t15-,17-,18-,19+,20+/m1/s1 |
| InChIKey | CUIUBTPOGPEPJU-XLSIIYIISA-N |
| XLogP | 1.96 |
| TPSA | 132.24 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.76 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|