C16H19NO7 — CID 18335849
[(2S,3R,5S,6S)-2,3,4,5,6-pentahydroxycyclohexyl] 2-(1H-indol-3-yl)acetate (PubChem CID 18335849) has the molecular formula C16H19NO7 and a molecular weight of 337.33 g/mol. Its IUPAC name is [(2S,3R,5S,6S)-2,3,4,5,6-pentahydroxycyclohexyl] 2-(1H-indol-3-yl)acetate.
| Compound Name | [(2S,3R,5S,6S)-2,3,4,5,6-pentahydroxycyclohexyl] 2-(1H-indol-3-yl)acetate |
|---|---|
| PubChem CID | 18335849 |
| Molecular Formula | C16H19NO7 |
| Molecular Weight | 337.33 g/mol |
| Exact Mass | 337.12 |
| IUPAC Name | [(2S,3R,5S,6S)-2,3,4,5,6-pentahydroxycyclohexyl] 2-(1H-indol-3-yl)acetate |
| SMILES | O=C(Cc1c[nH]c2ccccc12)OC1[C@@H](O)[C@H](O)C(O)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C16H19NO7/c18-10(5-7-6-17-9-4-2-1-3-8(7)9)24-16-14(22)12(20)11(19)13(21)15(16)23/h1-4,6,11-17,19-23H,5H2/t11?,12-,13+,14-,15-,16?/m0/s1 |
| InChIKey | XUACNUJFOIKYPQ-FSGNTSDLSA-N |
| XLogP | -1.56 |
| TPSA | 143.24 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.33 |
| LogP ≤ 5 | -1.56 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |