C12H11F3N2O2 — CID 15353207
3-(1H-indol-3-yl)-5-(trifluoromethyl)-1,2-oxazolidin-5-ol (PubChem CID 15353207) has the molecular formula C12H11F3N2O2 and a molecular weight of 272.23 g/mol. Its IUPAC name is 3-(1H-indol-3-yl)-5-(trifluoromethyl)-1,2-oxazolidin-5-ol.
| Compound Name | 3-(1H-indol-3-yl)-5-(trifluoromethyl)-1,2-oxazolidin-5-ol |
|---|---|
| PubChem CID | 15353207 |
| Molecular Formula | C12H11F3N2O2 |
| Molecular Weight | 272.23 g/mol |
| Exact Mass | 272.08 |
| IUPAC Name | 3-(1H-indol-3-yl)-5-(trifluoromethyl)-1,2-oxazolidin-5-ol |
| SMILES | OC1(C(F)(F)F)CC(c2c[nH]c3ccccc23)NO1 |
| InChI | InChI=1S/C12H11F3N2O2/c13-12(14,15)11(18)5-10(17-19-11)8-6-16-9-4-2-1-3-7(8)9/h1-4,6,10,16-18H,5H2 |
| InChIKey | WBPRTWGYRGMOKY-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 57.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.23 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |