C11H11F3N2O — CID 51922084
(2S)-3-amino-1,1,1-trifluoro-2-(1H-indol-3-yl)propan-2-ol (PubChem CID 51922084) has the molecular formula C11H11F3N2O and a molecular weight of 244.22 g/mol. Its IUPAC name is (2S)-3-amino-1,1,1-trifluoro-2-(1H-indol-3-yl)propan-2-ol.
| Compound Name | (2S)-3-amino-1,1,1-trifluoro-2-(1H-indol-3-yl)propan-2-ol |
|---|---|
| PubChem CID | 51922084 |
| Molecular Formula | C11H11F3N2O |
| Molecular Weight | 244.22 g/mol |
| Exact Mass | 244.08 |
| IUPAC Name | (2S)-3-amino-1,1,1-trifluoro-2-(1H-indol-3-yl)propan-2-ol |
| SMILES | NC[C@@](O)(c1c[nH]c2ccccc12)C(F)(F)F |
| InChI | InChI=1S/C11H11F3N2O/c12-11(13,14)10(17,6-15)8-5-16-9-4-2-1-3-7(8)9/h1-5,16-17H,6,15H2/t10-/m1/s1 |
| InChIKey | ADKNARNQNHGXIL-SNVBAGLBSA-N |
| XLogP | 1.88 |
| TPSA | 62.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.22 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |