C16H11ClF3NO — CID 42624729
(1R)-1-(4-chlorophenyl)-2,2,2-trifluoro-1-(1H-indol-3-yl)ethanol (PubChem CID 42624729) has the molecular formula C16H11ClF3NO and a molecular weight of 325.72 g/mol. Its IUPAC name is (1R)-1-(4-chlorophenyl)-2,2,2-trifluoro-1-(1H-indol-3-yl)ethanol.
| Compound Name | (1R)-1-(4-chlorophenyl)-2,2,2-trifluoro-1-(1H-indol-3-yl)ethanol |
|---|---|
| PubChem CID | 42624729 |
| Molecular Formula | C16H11ClF3NO |
| Molecular Weight | 325.72 g/mol |
| Exact Mass | 325.05 |
| IUPAC Name | (1R)-1-(4-chlorophenyl)-2,2,2-trifluoro-1-(1H-indol-3-yl)ethanol |
| SMILES | O[C@](c1ccc(Cl)cc1)(c1c[nH]c2ccccc12)C(F)(F)F |
| InChI | InChI=1S/C16H11ClF3NO/c17-11-7-5-10(6-8-11)15(22,16(18,19)20)13-9-21-14-4-2-1-3-12(13)14/h1-9,21-22H/t15-/m1/s1 |
| InChIKey | HIDMGZQDNIQSRR-OAHLLOKOSA-N |
| XLogP | 4.62 |
| TPSA | 36.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.72 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |