C22H20ClF3N2 — CID 176897884
6-chloro-3-[1,1,1-trifluoro-2-(1H-indol-3-yl)hexan-2-yl]-1H-indole (PubChem CID 176897884) has the molecular formula C22H20ClF3N2 and a molecular weight of 404.86 g/mol. Its IUPAC name is 6-chloro-3-[1,1,1-trifluoro-2-(1H-indol-3-yl)hexan-2-yl]-1H-indole.
| Compound Name | 6-chloro-3-[1,1,1-trifluoro-2-(1H-indol-3-yl)hexan-2-yl]-1H-indole |
|---|---|
| PubChem CID | 176897884 |
| Molecular Formula | C22H20ClF3N2 |
| Molecular Weight | 404.86 g/mol |
| Exact Mass | 404.13 |
| IUPAC Name | 6-chloro-3-[1,1,1-trifluoro-2-(1H-indol-3-yl)hexan-2-yl]-1H-indole |
| SMILES | CCCCC(c1c[nH]c2ccccc12)(c1c[nH]c2cc(Cl)ccc12)C(F)(F)F |
| InChI | InChI=1S/C22H20ClF3N2/c1-2-3-10-21(22(24,25)26,17-12-27-19-7-5-4-6-15(17)19)18-13-28-20-11-14(23)8-9-16(18)20/h4-9,11-13,27-28H,2-3,10H2,1H3 |
| InChIKey | JZOLFZJTCXCCEC-UHFFFAOYSA-N |
| XLogP | 7.34 |
| TPSA | 31.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.86 |
| LogP ≤ 5 | 7.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 0 |