C23H23F3N2 — CID 176897889
5-methyl-3-[1,1,1-trifluoro-2-(1H-indol-3-yl)hexan-2-yl]-1H-indole (PubChem CID 176897889) has the molecular formula C23H23F3N2 and a molecular weight of 384.45 g/mol. Its IUPAC name is 5-methyl-3-[1,1,1-trifluoro-2-(1H-indol-3-yl)hexan-2-yl]-1H-indole.
| Compound Name | 5-methyl-3-[1,1,1-trifluoro-2-(1H-indol-3-yl)hexan-2-yl]-1H-indole |
|---|---|
| PubChem CID | 176897889 |
| Molecular Formula | C23H23F3N2 |
| Molecular Weight | 384.45 g/mol |
| Exact Mass | 384.18 |
| IUPAC Name | 5-methyl-3-[1,1,1-trifluoro-2-(1H-indol-3-yl)hexan-2-yl]-1H-indole |
| SMILES | CCCCC(c1c[nH]c2ccccc12)(c1c[nH]c2ccc(C)cc12)C(F)(F)F |
| InChI | InChI=1S/C23H23F3N2/c1-3-4-11-22(23(24,25)26,18-13-27-20-8-6-5-7-16(18)20)19-14-28-21-10-9-15(2)12-17(19)21/h5-10,12-14,27-28H,3-4,11H2,1-2H3 |
| InChIKey | HFKCGLNPARAPND-UHFFFAOYSA-N |
| XLogP | 7.00 |
| TPSA | 31.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.45 |
| LogP ≤ 5 | 7.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 0 |