C28H34N2O — CID 101372934
2-(1H-indol-3-yl)-2-(5-methyl-1H-indol-3-yl)undecan-4-one (PubChem CID 101372934) has the molecular formula C28H34N2O and a molecular weight of 414.59 g/mol. Its IUPAC name is 2-(1H-indol-3-yl)-2-(5-methyl-1H-indol-3-yl)undecan-4-one.
| Compound Name | 2-(1H-indol-3-yl)-2-(5-methyl-1H-indol-3-yl)undecan-4-one |
|---|---|
| PubChem CID | 101372934 |
| Molecular Formula | C28H34N2O |
| Molecular Weight | 414.59 g/mol |
| Exact Mass | 414.27 |
| IUPAC Name | 2-(1H-indol-3-yl)-2-(5-methyl-1H-indol-3-yl)undecan-4-one |
| SMILES | CCCCCCCC(=O)CC(C)(c1c[nH]c2ccccc12)c1c[nH]c2ccc(C)cc12 |
| InChI | InChI=1S/C28H34N2O/c1-4-5-6-7-8-11-21(31)17-28(3,24-18-29-26-13-10-9-12-22(24)26)25-19-30-27-15-14-20(2)16-23(25)27/h9-10,12-16,18-19,29-30H,4-8,11,17H2,1-3H3 |
| InChIKey | COVQRUBAJJNIAM-UHFFFAOYSA-N |
| XLogP | 7.58 |
| TPSA | 48.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.59 |
| LogP ≤ 5 | 7.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|