C17H26Cl2N2O2 — CID 174428553
3-amino-3-(1H-indol-3-yl)nonanoic acid;dihydrochloride (PubChem CID 174428553) has the molecular formula C17H26Cl2N2O2 and a molecular weight of 361.31 g/mol. Its IUPAC name is 3-amino-3-(1H-indol-3-yl)nonanoic acid;dihydrochloride.
| Compound Name | 3-amino-3-(1H-indol-3-yl)nonanoic acid;dihydrochloride |
|---|---|
| PubChem CID | 174428553 |
| Molecular Formula | C17H26Cl2N2O2 |
| Molecular Weight | 361.31 g/mol |
| Exact Mass | 360.14 |
| IUPAC Name | 3-amino-3-(1H-indol-3-yl)nonanoic acid;dihydrochloride |
| SMILES | CCCCCCC(N)(CC(=O)O)c1c[nH]c2ccccc12.Cl.Cl |
| InChI | InChI=1S/C17H24N2O2.2ClH/c1-2-3-4-7-10-17(18,11-16(20)21)14-12-19-15-9-6-5-8-13(14)15;;/h5-6,8-9,12,19H,2-4,7,10-11,18H2,1H3,(H,20,21);2*1H |
| InChIKey | AKPAWGRTYGINHH-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 79.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.31 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|