C14H22N2O2Si — CID 159014454
(2S)-2-amino-3-(1H-indol-3-yl)-2,3-dimethylbutanoic acid;silane (PubChem CID 159014454) has the molecular formula C14H22N2O2Si and a molecular weight of 278.43 g/mol. Its IUPAC name is (2S)-2-amino-3-(1H-indol-3-yl)-2,3-dimethylbutanoic acid;silane.
| Compound Name | (2S)-2-amino-3-(1H-indol-3-yl)-2,3-dimethylbutanoic acid;silane |
|---|---|
| PubChem CID | 159014454 |
| Molecular Formula | C14H22N2O2Si |
| Molecular Weight | 278.43 g/mol |
| Exact Mass | 278.15 |
| IUPAC Name | (2S)-2-amino-3-(1H-indol-3-yl)-2,3-dimethylbutanoic acid;silane |
| SMILES | CC(C)(c1c[nH]c2ccccc12)[C@](C)(N)C(=O)O.[SiH4] |
| InChI | InChI=1S/C14H18N2O2.H4Si/c1-13(2,14(3,15)12(17)18)10-8-16-11-7-5-4-6-9(10)11;/h4-8,16H,15H2,1-3H3,(H,17,18);1H4/t14-;/m1./s1 |
| InChIKey | JSXIQOFNJRRYLG-PFEQFJNWSA-N |
| XLogP | 0.80 |
| TPSA | 79.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.43 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|