C16H22N2O — CID 113208983
N-tert-butyl-2-(1H-indol-3-yl)-2-methylpropanamide (PubChem CID 113208983) has the molecular formula C16H22N2O and a molecular weight of 258.37 g/mol. Its IUPAC name is N-tert-butyl-2-(1H-indol-3-yl)-2-methylpropanamide.
| Compound Name | N-tert-butyl-2-(1H-indol-3-yl)-2-methylpropanamide |
|---|---|
| PubChem CID | 113208983 |
| Molecular Formula | C16H22N2O |
| Molecular Weight | 258.37 g/mol |
| Exact Mass | 258.17 |
| IUPAC Name | N-tert-butyl-2-(1H-indol-3-yl)-2-methylpropanamide |
| SMILES | CC(C)(C)NC(=O)C(C)(C)c1c[nH]c2ccccc12 |
| InChI | InChI=1S/C16H22N2O/c1-15(2,3)18-14(19)16(4,5)12-10-17-13-9-7-6-8-11(12)13/h6-10,17H,1-5H3,(H,18,19) |
| InChIKey | KYMMQFNWFXWNMC-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 44.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.37 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |