C12H11NO4 — CID 70075508
2-(1H-indol-3-yl)-2-methylpropanedioic acid (PubChem CID 70075508) has the molecular formula C12H11NO4 and a molecular weight of 233.22 g/mol. Its IUPAC name is 2-(1H-indol-3-yl)-2-methylpropanedioic acid.
| Compound Name | 2-(1H-indol-3-yl)-2-methylpropanedioic acid |
|---|---|
| PubChem CID | 70075508 |
| Molecular Formula | C12H11NO4 |
| Molecular Weight | 233.22 g/mol |
| Exact Mass | 233.07 |
| IUPAC Name | 2-(1H-indol-3-yl)-2-methylpropanedioic acid |
| SMILES | CC(C(=O)O)(C(=O)O)c1c[nH]c2ccccc12 |
| InChI | InChI=1S/C12H11NO4/c1-12(10(14)15,11(16)17)8-6-13-9-5-3-2-4-7(8)9/h2-6,13H,1H3,(H,14,15)(H,16,17) |
| InChIKey | ATTFJOLYLNLPLD-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 90.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.22 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|