C13H14N2O3 — CID 115163934
3-(1H-indol-3-ylamino)-2,2-dimethyl-3-oxopropanoic acid (PubChem CID 115163934) has the molecular formula C13H14N2O3 and a molecular weight of 246.27 g/mol. Its IUPAC name is 3-(1H-indol-3-ylamino)-2,2-dimethyl-3-oxopropanoic acid.
| Compound Name | 3-(1H-indol-3-ylamino)-2,2-dimethyl-3-oxopropanoic acid |
|---|---|
| PubChem CID | 115163934 |
| Molecular Formula | C13H14N2O3 |
| Molecular Weight | 246.27 g/mol |
| Exact Mass | 246.10 |
| IUPAC Name | 3-(1H-indol-3-ylamino)-2,2-dimethyl-3-oxopropanoic acid |
| SMILES | CC(C)(C(=O)O)C(=O)Nc1c[nH]c2ccccc12 |
| InChI | InChI=1S/C13H14N2O3/c1-13(2,12(17)18)11(16)15-10-7-14-9-6-4-3-5-8(9)10/h3-7,14H,1-2H3,(H,15,16)(H,17,18) |
| InChIKey | UBHRRNOTGQCHJA-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 82.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.27 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|