About 1H-indol-3-ylcarbamic acid
1H-indol-3-ylcarbamic acid (PubChem CID 66672709) has the molecular formula C9H8N2O2
and a molecular weight of 176.17 g/mol. Its IUPAC name is 1H-indol-3-ylcarbamic acid.
Molecular Properties
| Compound Name | 1H-indol-3-ylcarbamic acid |
| PubChem CID | 66672709 |
| Molecular Formula | C9H8N2O2 |
| Molecular Weight | 176.17 g/mol |
| Exact Mass | 176.06 |
| IUPAC Name | 1H-indol-3-ylcarbamic acid |
| SMILES | O=C(O)Nc1c[nH]c2ccccc12 |
| InChI | InChI=1S/C9H8N2O2/c12-9(13)11-8-5-10-7-4-2-1-3-6(7)8/h1-5,10-11H,(H,12,13) |
| InChIKey | URWBEJAHOLLXRX-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 65.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 176.17 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 1H-indol-3-ylcarbamic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1H-indol-3-ylcarbamic acid?
The IUPAC name of 1H-indol-3-ylcarbamic acid (CID 66672709) is 1H-indol-3-ylcarbamic acid.
What is the SMILES notation for 1H-indol-3-ylcarbamic acid?
The canonical SMILES for 1H-indol-3-ylcarbamic acid is O=C(O)Nc1c[nH]c2ccccc12.
What is the InChIKey of 1H-indol-3-ylcarbamic acid?
The InChIKey is URWBEJAHOLLXRX-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H8N2O2/c12-9(13)11-8-5-10-7-4-2-1-3-6(7)8/h1-5,10-11H,(H,12,13).
What are the key properties of 1H-indol-3-ylcarbamic acid?
1H-indol-3-ylcarbamic acid has a molecular weight of 176.17 g/mol, XLogP of 2.26, 1 rotatable bonds, 3 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1H-indol-3-ylcarbamic acid is sourced from PubChem (CID 66672709), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).