About 1H-indol-3-ylthiourea;hydroiodide
1H-indol-3-ylthiourea;hydroiodide (PubChem CID 173290305) has the molecular formula C9H10IN3S
and a molecular weight of 319.17 g/mol. Its IUPAC name is 1H-indol-3-ylthiourea;hydroiodide.
Molecular Properties
| Compound Name | 1H-indol-3-ylthiourea;hydroiodide |
| PubChem CID | 173290305 |
| Molecular Formula | C9H10IN3S |
| Molecular Weight | 319.17 g/mol |
| Exact Mass | 318.96 |
| IUPAC Name | 1H-indol-3-ylthiourea;hydroiodide |
| SMILES | I.NC(=S)Nc1c[nH]c2ccccc12 |
| InChI | InChI=1S/C9H9N3S.HI/c10-9(13)12-8-5-11-7-4-2-1-3-6(7)8;/h1-5,11H,(H3,10,12,13);1H |
| InChIKey | AWFCHQYCTCFIGU-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 53.84 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 319.17 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 1H-indol-3-ylthiourea;hydroiodide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1H-indol-3-ylthiourea;hydroiodide?
The IUPAC name of 1H-indol-3-ylthiourea;hydroiodide (CID 173290305) is 1H-indol-3-ylthiourea;hydroiodide.
What is the SMILES notation for 1H-indol-3-ylthiourea;hydroiodide?
The canonical SMILES for 1H-indol-3-ylthiourea;hydroiodide is I.NC(=S)Nc1c[nH]c2ccccc12.
What is the InChIKey of 1H-indol-3-ylthiourea;hydroiodide?
The InChIKey is AWFCHQYCTCFIGU-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H9N3S.HI/c10-9(13)12-8-5-11-7-4-2-1-3-6(7)8;/h1-5,11H,(H3,10,12,13);1H.
What are the key properties of 1H-indol-3-ylthiourea;hydroiodide?
1H-indol-3-ylthiourea;hydroiodide has a molecular weight of 319.17 g/mol, XLogP of 2.44, 1 rotatable bonds, 3 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1H-indol-3-ylthiourea;hydroiodide is sourced from PubChem (CID 173290305), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).