C20H22N2O2 — CID 132967723
[(3R)-oct-1-yn-3-yl] (2S)-2-cyano-2-(1H-indol-3-yl)propanoate (PubChem CID 132967723) has the molecular formula C20H22N2O2 and a molecular weight of 322.41 g/mol. Its IUPAC name is [(3R)-oct-1-yn-3-yl] (2S)-2-cyano-2-(1H-indol-3-yl)propanoate.
| Compound Name | [(3R)-oct-1-yn-3-yl] (2S)-2-cyano-2-(1H-indol-3-yl)propanoate |
|---|---|
| PubChem CID | 132967723 |
| Molecular Formula | C20H22N2O2 |
| Molecular Weight | 322.41 g/mol |
| Exact Mass | 322.17 |
| IUPAC Name | [(3R)-oct-1-yn-3-yl] (2S)-2-cyano-2-(1H-indol-3-yl)propanoate |
| SMILES | C#C[C@@H](CCCCC)OC(=O)[C@](C)(C#N)c1c[nH]c2ccccc12 |
| InChI | InChI=1S/C20H22N2O2/c1-4-6-7-10-15(5-2)24-19(23)20(3,14-21)17-13-22-18-12-9-8-11-16(17)18/h2,8-9,11-13,15,22H,4,6-7,10H2,1,3H3/t15-,20+/m0/s1 |
| InChIKey | ZFSJRDQCZZVAAX-MGPUTAFESA-N |
| XLogP | 4.07 |
| TPSA | 65.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.41 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|